C20H19Cl2N3OS3 — CID 17321788
2-[(3,4-dichlorophenyl)methylsulfanyl]-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17321788) has the molecular formula C20H19Cl2N3OS3 and a molecular weight of 484.50 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17321788 |
| Molecular Formula | C20H19Cl2N3OS3 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)c(Cl)c1)Nc1nnc(SCCCc2ccccc2)s1 |
| InChI | InChI=1S/C20H19Cl2N3OS3/c21-16-9-8-15(11-17(16)22)12-27-13-18(26)23-19-24-25-20(29-19)28-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11H,4,7,10,12-13H2,(H,23,24,26) |
| InChIKey | DPYJLDUKLDWSET-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|