C18H15Cl2N3OS2 — CID 2192003
N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide (PubChem CID 2192003) has the molecular formula C18H15Cl2N3OS2 and a molecular weight of 424.38 g/mol. Its IUPAC name is N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide.
| Compound Name | N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 2192003 |
| Molecular Formula | C18H15Cl2N3OS2 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1nnc(SCc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C18H15Cl2N3OS2/c19-14-8-6-13(10-15(14)20)11-25-18-23-22-17(26-18)21-16(24)9-7-12-4-2-1-3-5-12/h1-6,8,10H,7,9,11H2,(H,21,22,24) |
| InChIKey | UTUOZBIHXHKECU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|