C15H11Cl2N3OS3 — CID 40833756
N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 40833756) has the molecular formula C15H11Cl2N3OS3 and a molecular weight of 416.38 g/mol. Its IUPAC name is N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 40833756 |
| Molecular Formula | C15H11Cl2N3OS3 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 414.94 |
| IUPAC Name | N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1nnc(SCc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C15H11Cl2N3OS3/c16-11-4-3-9(6-12(11)17)8-23-15-20-19-14(24-15)18-13(21)7-10-2-1-5-22-10/h1-6H,7-8H2,(H,18,19,21) |
| InChIKey | KHECCMWIDDCTCL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|