C18H19N3O4S3 — CID 55382470
N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 55382470) has the molecular formula C18H19N3O4S3 and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55382470 |
| Molecular Formula | C18H19N3O4S3 |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2nnc(SCc3cccs3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N3O4S3/c1-23-13-7-11(8-14(24-2)16(13)25-3)9-15(22)19-17-20-21-18(28-17)27-10-12-5-4-6-26-12/h4-8H,9-10H2,1-3H3,(H,19,20,22) |
| InChIKey | JGCUGUOSUIMLKZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|