C17H16N4O3S3 — CID 43814601
4-methoxy-N-[5-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 43814601) has the molecular formula C17H16N4O3S3 and a molecular weight of 420.54 g/mol. Its IUPAC name is 4-methoxy-N-[5-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[5-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 43814601 |
| Molecular Formula | C17H16N4O3S3 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 4-methoxy-N-[5-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(SCC(=O)NCc3cccs3)s2)cc1 |
| InChI | InChI=1S/C17H16N4O3S3/c1-24-12-6-4-11(5-7-12)15(23)19-16-20-21-17(27-16)26-10-14(22)18-9-13-3-2-8-25-13/h2-8H,9-10H2,1H3,(H,18,22)(H,19,20,23) |
| InChIKey | XNPJSHRYXKIULF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|