C12H13N3O2S2 — CID 735257
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxybenzamide (PubChem CID 735257) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxybenzamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 735257 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxybenzamide |
| SMILES | CCSc1nnc(NC(=O)c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C12H13N3O2S2/c1-3-18-12-15-14-11(19-12)13-10(16)8-4-6-9(17-2)7-5-8/h4-7H,3H2,1-2H3,(H,13,14,16) |
| InChIKey | GUPBWHATWKHXGQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|