C13H15N3O3S3 — CID 7688601
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(methylsulfonylmethyl)benzamide (PubChem CID 7688601) has the molecular formula C13H15N3O3S3 and a molecular weight of 357.48 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 7688601 |
| Molecular Formula | C13H15N3O3S3 |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(methylsulfonylmethyl)benzamide |
| SMILES | CCSc1nnc(NC(=O)c2ccc(CS(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C13H15N3O3S3/c1-3-20-13-16-15-12(21-13)14-11(17)10-6-4-9(5-7-10)8-22(2,18)19/h4-7H,3,8H2,1-2H3,(H,14,15,17) |
| InChIKey | KCEUQLIOZYCRPA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|