C19H19FN4O3S3 — CID 100502734
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[(2-fluoro-N-methylsulfonylanilino)methyl]benzamide (PubChem CID 100502734) has the molecular formula C19H19FN4O3S3 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[(2-fluoro-N-methylsulfonylanilino)methyl]benzamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[(2-fluoro-N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 100502734 |
| Molecular Formula | C19H19FN4O3S3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[(2-fluoro-N-methylsulfonylanilino)methyl]benzamide |
| SMILES | CCSc1nnc(NC(=O)c2ccc(CN(c3ccccc3F)S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C19H19FN4O3S3/c1-3-28-19-23-22-18(29-19)21-17(25)14-10-8-13(9-11-14)12-24(30(2,26)27)16-7-5-4-6-15(16)20/h4-11H,3,12H2,1-2H3,(H,21,22,25) |
| InChIKey | PBSDTADNKNKVDD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|