C24H26FN3O3S2 — CID 28569994
4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]-N-(2-ethylsulfanylphenyl)benzamide (PubChem CID 28569994) has the molecular formula C24H26FN3O3S2 and a molecular weight of 487.62 g/mol. Its IUPAC name is 4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]-N-(2-ethylsulfanylphenyl)benzamide.
| Compound Name | 4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]-N-(2-ethylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 28569994 |
| Molecular Formula | C24H26FN3O3S2 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]-N-(2-ethylsulfanylphenyl)benzamide |
| SMILES | CCSc1ccccc1NC(=O)c1ccc(CN(c2ccccc2F)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C24H26FN3O3S2/c1-4-32-23-12-8-6-10-21(23)26-24(29)19-15-13-18(14-16-19)17-28(33(30,31)27(2)3)22-11-7-5-9-20(22)25/h5-16H,4,17H2,1-3H3,(H,26,29) |
| InChIKey | XJLQGCSQWJPXLA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |