C23H23FN4O4S — CID 53283325
3-[[4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzoyl]amino]benzamide (PubChem CID 53283325) has the molecular formula C23H23FN4O4S and a molecular weight of 470.53 g/mol. Its IUPAC name is 3-[[4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzoyl]amino]benzamide.
| Compound Name | 3-[[4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 53283325 |
| Molecular Formula | C23H23FN4O4S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 3-[[4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzoyl]amino]benzamide |
| SMILES | CN(C)S(=O)(=O)N(Cc1ccc(C(=O)Nc2cccc(C(N)=O)c2)cc1)c1ccccc1F |
| InChI | InChI=1S/C23H23FN4O4S/c1-27(2)33(31,32)28(21-9-4-3-8-20(21)24)15-16-10-12-17(13-11-16)23(30)26-19-7-5-6-18(14-19)22(25)29/h3-14H,15H2,1-2H3,(H2,25,29)(H,26,30) |
| InChIKey | YUFLYMVWAOMZOH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |