C24H25ClFN3O3S2 — CID 18891092
N-[2-(4-chlorophenyl)sulfanylethyl]-4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzamide (PubChem CID 18891092) has the molecular formula C24H25ClFN3O3S2 and a molecular weight of 522.07 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzamide |
|---|---|
| PubChem CID | 18891092 |
| Molecular Formula | C24H25ClFN3O3S2 |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzamide |
| SMILES | CN(C)S(=O)(=O)N(Cc1ccc(C(=O)NCCSc2ccc(Cl)cc2)cc1)c1ccccc1F |
| InChI | InChI=1S/C24H25ClFN3O3S2/c1-28(2)34(31,32)29(23-6-4-3-5-22(23)26)17-18-7-9-19(10-8-18)24(30)27-15-16-33-21-13-11-20(25)12-14-21/h3-14H,15-17H2,1-2H3,(H,27,30) |
| InChIKey | KWNXEDJYCJYSIW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|