C23H23F2N3O3S — CID 53283286
4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]-N-[(2-fluorophenyl)methyl]benzamide (PubChem CID 53283286) has the molecular formula C23H23F2N3O3S and a molecular weight of 459.52 g/mol. Its IUPAC name is 4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]-N-[(2-fluorophenyl)methyl]benzamide.
| Compound Name | 4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]-N-[(2-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 53283286 |
| Molecular Formula | C23H23F2N3O3S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]-N-[(2-fluorophenyl)methyl]benzamide |
| SMILES | CN(C)S(=O)(=O)N(Cc1ccc(C(=O)NCc2ccccc2F)cc1)c1ccccc1F |
| InChI | InChI=1S/C23H23F2N3O3S/c1-27(2)32(30,31)28(22-10-6-5-9-21(22)25)16-17-11-13-18(14-12-17)23(29)26-15-19-7-3-4-8-20(19)24/h3-14H,15-16H2,1-2H3,(H,26,29) |
| InChIKey | RBGAWDMZZHMOEK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |