C20H27N3OS2 — CID 3249153
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-propylcyclohexyl)benzamide (PubChem CID 3249153) has the molecular formula C20H27N3OS2 and a molecular weight of 389.59 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-propylcyclohexyl)benzamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-propylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 3249153 |
| Molecular Formula | C20H27N3OS2 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-propylcyclohexyl)benzamide |
| SMILES | CCCC1CCC(c2ccc(C(=O)Nc3nnc(SCC)s3)cc2)CC1 |
| InChI | InChI=1S/C20H27N3OS2/c1-3-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(24)21-19-22-23-20(26-19)25-4-2/h10-15H,3-9H2,1-2H3,(H,21,22,24) |
| InChIKey | PIQIGLNEVHNPNB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|