C20H17N3O3S2 — CID 19226665
4-(2-oxo-2-phenylacetyl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 19226665) has the molecular formula C20H17N3O3S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-(2-oxo-2-phenylacetyl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-(2-oxo-2-phenylacetyl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 19226665 |
| Molecular Formula | C20H17N3O3S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 4-(2-oxo-2-phenylacetyl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCSc1nnc(NC(=O)c2ccc(C(=O)C(=O)c3ccccc3)cc2)s1 |
| InChI | InChI=1S/C20H17N3O3S2/c1-2-12-27-20-23-22-19(28-20)21-18(26)15-10-8-14(9-11-15)17(25)16(24)13-6-4-3-5-7-13/h3-11H,2,12H2,1H3,(H,21,22,26) |
| InChIKey | QKJOPWWBNJCOEK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|