C19H19N3O2S2 — CID 26175377
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-propoxybenzamide (PubChem CID 26175377) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-propoxybenzamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-propoxybenzamide |
|---|---|
| PubChem CID | 26175377 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2nnc(SCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C19H19N3O2S2/c1-2-12-24-16-10-8-15(9-11-16)17(23)20-18-21-22-19(26-18)25-13-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H,20,21,23) |
| InChIKey | QUHMQXOPRZEDCM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|