C23H19N3O2S2 — CID 16651015
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3-methylphenoxy)benzamide (PubChem CID 16651015) has the molecular formula C23H19N3O2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3-methylphenoxy)benzamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3-methylphenoxy)benzamide |
|---|---|
| PubChem CID | 16651015 |
| Molecular Formula | C23H19N3O2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(3-methylphenoxy)benzamide |
| SMILES | Cc1cccc(Oc2ccc(C(=O)Nc3nnc(SCc4ccccc4)s3)cc2)c1 |
| InChI | InChI=1S/C23H19N3O2S2/c1-16-6-5-9-20(14-16)28-19-12-10-18(11-13-19)21(27)24-22-25-26-23(30-22)29-15-17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,24,25,27) |
| InChIKey | PDKGTOIOKBSCOF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|