C24H21N3O2S3 — CID 100582559
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(2-phenylsulfanylethoxy)benzamide (PubChem CID 100582559) has the molecular formula C24H21N3O2S3 and a molecular weight of 479.65 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(2-phenylsulfanylethoxy)benzamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(2-phenylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 100582559 |
| Molecular Formula | C24H21N3O2S3 |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(2-phenylsulfanylethoxy)benzamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)c1ccc(OCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O2S3/c28-22(25-23-26-27-24(32-23)31-17-18-7-3-1-4-8-18)19-11-13-20(14-12-19)29-15-16-30-21-9-5-2-6-10-21/h1-14H,15-17H2,(H,25,26,28) |
| InChIKey | UUDOHLIRLPBNJU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|