C16H11F3N4OS2 — CID 33166888
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 33166888) has the molecular formula C16H11F3N4OS2 and a molecular weight of 396.42 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 33166888 |
| Molecular Formula | C16H11F3N4OS2 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H11F3N4OS2/c17-16(18,19)12-7-6-11(8-20-12)13(24)21-14-22-23-15(26-14)25-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,21,22,24) |
| InChIKey | QDPHCKOECHUDPG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|