C14H11N5OS2 — CID 46937369
N-[5-(pyridin-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide (PubChem CID 46937369) has the molecular formula C14H11N5OS2 and a molecular weight of 329.41 g/mol. Its IUPAC name is N-[5-(pyridin-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[5-(pyridin-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46937369 |
| Molecular Formula | C14H11N5OS2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-[5-(pyridin-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccnc2)s1)c1cccnc1 |
| InChI | InChI=1S/C14H11N5OS2/c20-12(11-4-2-6-16-8-11)17-13-18-19-14(22-13)21-9-10-3-1-5-15-7-10/h1-8H,9H2,(H,17,18,20) |
| InChIKey | OHNIKGQOEDYEND-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|