C15H11FN4OS2 — CID 2678901
N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide (PubChem CID 2678901) has the molecular formula C15H11FN4OS2 and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 2678901 |
| Molecular Formula | C15H11FN4OS2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2F)s1)c1ccncc1 |
| InChI | InChI=1S/C15H11FN4OS2/c16-12-4-2-1-3-11(12)9-22-15-20-19-14(23-15)18-13(21)10-5-7-17-8-6-10/h1-8H,9H2,(H,18,19,21) |
| InChIKey | SIHAZMKRGVUQNI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|