C18H16FN3O2S2 — CID 42805409
N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenylmethoxyacetamide (PubChem CID 42805409) has the molecular formula C18H16FN3O2S2 and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenylmethoxyacetamide.
| Compound Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 42805409 |
| Molecular Formula | C18H16FN3O2S2 |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenylmethoxyacetamide |
| SMILES | O=C(COCc1ccccc1)Nc1nnc(SCc2ccccc2F)s1 |
| InChI | InChI=1S/C18H16FN3O2S2/c19-15-9-5-4-8-14(15)12-25-18-22-21-17(26-18)20-16(23)11-24-10-13-6-2-1-3-7-13/h1-9H,10-12H2,(H,20,21,23) |
| InChIKey | VQRXWBFIJUTWNC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|