C18H11ClFN3OS3 — CID 18864830
3-chloro-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 18864830) has the molecular formula C18H11ClFN3OS3 and a molecular weight of 435.96 g/mol. Its IUPAC name is 3-chloro-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18864830 |
| Molecular Formula | C18H11ClFN3OS3 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 434.97 |
| IUPAC Name | 3-chloro-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2F)s1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H11ClFN3OS3/c19-14-11-6-2-4-8-13(11)26-15(14)16(24)21-17-22-23-18(27-17)25-9-10-5-1-3-7-12(10)20/h1-8H,9H2,(H,21,22,24) |
| InChIKey | UEIJRTMZFYXAAR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|