C19H13Cl2N3OS3 — CID 18864664
3,4-dichloro-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 18864664) has the molecular formula C19H13Cl2N3OS3 and a molecular weight of 466.44 g/mol. Its IUPAC name is 3,4-dichloro-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18864664 |
| Molecular Formula | C19H13Cl2N3OS3 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 464.96 |
| IUPAC Name | 3,4-dichloro-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccccc1CSc1nnc(NC(=O)c2sc3cccc(Cl)c3c2Cl)s1 |
| InChI | InChI=1S/C19H13Cl2N3OS3/c1-10-5-2-3-6-11(10)9-26-19-24-23-18(28-19)22-17(25)16-15(21)14-12(20)7-4-8-13(14)27-16/h2-8H,9H2,1H3,(H,22,23,25) |
| InChIKey | XWJYOZQTPXRZRB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|