C21H17N3OS2 — CID 44957715
N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide (PubChem CID 44957715) has the molecular formula C21H17N3OS2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 44957715 |
| Molecular Formula | C21H17N3OS2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide |
| SMILES | Cc1ccccc1CSc1nnc(NC(=O)c2ccc3ccccc3c2)s1 |
| InChI | InChI=1S/C21H17N3OS2/c1-14-6-2-3-9-18(14)13-26-21-24-23-20(27-21)22-19(25)17-11-10-15-7-4-5-8-16(15)12-17/h2-12H,13H2,1H3,(H,22,23,25) |
| InChIKey | IYPQIUQXTSBVJP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|