C20H20ClFN4O3S3 — CID 16550788
2-chloro-5-(diethylsulfamoyl)-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 16550788) has the molecular formula C20H20ClFN4O3S3 and a molecular weight of 515.06 g/mol. Its IUPAC name is 2-chloro-5-(diethylsulfamoyl)-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-5-(diethylsulfamoyl)-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 16550788 |
| Molecular Formula | C20H20ClFN4O3S3 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | 2-chloro-5-(diethylsulfamoyl)-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2nnc(SCc3ccccc3F)s2)c1 |
| InChI | InChI=1S/C20H20ClFN4O3S3/c1-3-26(4-2)32(28,29)14-9-10-16(21)15(11-14)18(27)23-19-24-25-20(31-19)30-12-13-7-5-6-8-17(13)22/h5-11H,3-4,12H2,1-2H3,(H,23,24,27) |
| InChIKey | JBZWVGORPDFLBI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|