C16H11Cl2FN4OS2 — CID 1388441
1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2-fluorophenyl)urea (PubChem CID 1388441) has the molecular formula C16H11Cl2FN4OS2 and a molecular weight of 429.33 g/mol. Its IUPAC name is 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 1388441 |
| Molecular Formula | C16H11Cl2FN4OS2 |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2-fluorophenyl)urea |
| SMILES | O=C(Nc1nnc(SCc2ccc(Cl)cc2Cl)s1)Nc1ccccc1F |
| InChI | InChI=1S/C16H11Cl2FN4OS2/c17-10-6-5-9(11(18)7-10)8-25-16-23-22-15(26-16)21-14(24)20-13-4-2-1-3-12(13)19/h1-7H,8H2,(H2,20,21,22,24) |
| InChIKey | SXFQEGYJZWJRSX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|