C16H10Cl2IN3OS2 — CID 100514658
N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-iodobenzamide (PubChem CID 100514658) has the molecular formula C16H10Cl2IN3OS2 and a molecular weight of 522.22 g/mol. Its IUPAC name is N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-iodobenzamide.
| Compound Name | N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-iodobenzamide |
|---|---|
| PubChem CID | 100514658 |
| Molecular Formula | C16H10Cl2IN3OS2 |
| Molecular Weight | 522.22 g/mol |
| Exact Mass | 520.87 |
| IUPAC Name | N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-iodobenzamide |
| SMILES | O=C(Nc1nnc(SCc2ccc(Cl)cc2Cl)s1)c1cccc(I)c1 |
| InChI | InChI=1S/C16H10Cl2IN3OS2/c17-11-5-4-10(13(18)7-11)8-24-16-22-21-15(25-16)20-14(23)9-2-1-3-12(19)6-9/h1-7H,8H2,(H,20,21,23) |
| InChIKey | RHBHJQSJYRNHGS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.22 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|