C18H12Cl3N3OS2 — CID 3325271
3-(4-chlorophenyl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 3325271) has the molecular formula C18H12Cl3N3OS2 and a molecular weight of 456.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3325271 |
| Molecular Formula | C18H12Cl3N3OS2 |
| Molecular Weight | 456.81 g/mol |
| Exact Mass | 454.95 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)Nc1nnc(SCc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C18H12Cl3N3OS2/c19-13-5-1-11(2-6-13)3-8-16(25)22-17-23-24-18(27-17)26-10-12-4-7-14(20)9-15(12)21/h1-9H,10H2,(H,22,23,25) |
| InChIKey | HLLGPAJWLQEWIV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.81 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|