C16H10Cl3N3OS2 — CID 3324338
4-chloro-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 3324338) has the molecular formula C16H10Cl3N3OS2 and a molecular weight of 430.77 g/mol. Its IUPAC name is 4-chloro-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3324338 |
| Molecular Formula | C16H10Cl3N3OS2 |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | 4-chloro-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(SCc2ccc(Cl)cc2Cl)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10Cl3N3OS2/c17-11-4-1-9(2-5-11)14(23)20-15-21-22-16(25-15)24-8-10-3-6-12(18)7-13(10)19/h1-7H,8H2,(H,20,21,23) |
| InChIKey | XIJNDDMGUUOEBK-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|