C17H12Cl2IN3O2S2 — CID 3328715
N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-iodophenoxy)acetamide (PubChem CID 3328715) has the molecular formula C17H12Cl2IN3O2S2 and a molecular weight of 552.25 g/mol. Its IUPAC name is N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-iodophenoxy)acetamide.
| Compound Name | N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-iodophenoxy)acetamide |
|---|---|
| PubChem CID | 3328715 |
| Molecular Formula | C17H12Cl2IN3O2S2 |
| Molecular Weight | 552.25 g/mol |
| Exact Mass | 550.88 |
| IUPAC Name | N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-iodophenoxy)acetamide |
| SMILES | O=C(COc1ccc(I)cc1)Nc1nnc(SCc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C17H12Cl2IN3O2S2/c18-11-2-1-10(14(19)7-11)9-26-17-23-22-16(27-17)21-15(24)8-25-13-5-3-12(20)4-6-13/h1-7H,8-9H2,(H,21,22,24) |
| InChIKey | SRVGRBWNZHGACP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.25 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|