C18H14Cl3N3O2S2 — CID 3327775
2-(4-chloro-3-methylphenoxy)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 3327775) has the molecular formula C18H14Cl3N3O2S2 and a molecular weight of 474.82 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3327775 |
| Molecular Formula | C18H14Cl3N3O2S2 |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 472.96 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2nnc(SCc3ccc(Cl)cc3Cl)s2)ccc1Cl |
| InChI | InChI=1S/C18H14Cl3N3O2S2/c1-10-6-13(4-5-14(10)20)26-8-16(25)22-17-23-24-18(28-17)27-9-11-2-3-12(19)7-15(11)21/h2-7H,8-9H2,1H3,(H,22,23,25) |
| InChIKey | YDKATAALASGRSJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|