C20H19Cl2N3O2S2 — CID 3327773
N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3,5-dimethylphenoxy)propanamide (PubChem CID 3327773) has the molecular formula C20H19Cl2N3O2S2 and a molecular weight of 468.43 g/mol. Its IUPAC name is N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3,5-dimethylphenoxy)propanamide.
| Compound Name | N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3,5-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 3327773 |
| Molecular Formula | C20H19Cl2N3O2S2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3,5-dimethylphenoxy)propanamide |
| SMILES | Cc1cc(C)cc(OC(C)C(=O)Nc2nnc(SCc3ccc(Cl)cc3Cl)s2)c1 |
| InChI | InChI=1S/C20H19Cl2N3O2S2/c1-11-6-12(2)8-16(7-11)27-13(3)18(26)23-19-24-25-20(29-19)28-10-14-4-5-15(21)9-17(14)22/h4-9,13H,10H2,1-3H3,(H,23,24,26) |
| InChIKey | LSNYNBMOHSXPIF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|