C14H16ClN3O2S2 — CID 100772933
(2S)-2-(4-chlorophenoxy)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 100772933) has the molecular formula C14H16ClN3O2S2 and a molecular weight of 357.89 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2S)-2-(4-chlorophenoxy)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 100772933 |
| Molecular Formula | C14H16ClN3O2S2 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCCSc1nnc(NC(=O)[C@H](C)Oc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C14H16ClN3O2S2/c1-3-8-21-14-18-17-13(22-14)16-12(19)9(2)20-11-6-4-10(15)5-7-11/h4-7,9H,3,8H2,1-2H3,(H,16,17,19)/t9-/m0/s1 |
| InChIKey | LNFMTJGAQFJKGD-VIFPVBQESA-N |
| XLogP | 4.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|