C13H13Cl2N3O2S2 — CID 7858558
(2R)-2-(2,4-dichlorophenoxy)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 7858558) has the molecular formula C13H13Cl2N3O2S2 and a molecular weight of 378.31 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 7858558 |
| Molecular Formula | C13H13Cl2N3O2S2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCSc1nnc(NC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C13H13Cl2N3O2S2/c1-3-21-13-18-17-12(22-13)16-11(19)7(2)20-10-5-4-8(14)6-9(10)15/h4-7H,3H2,1-2H3,(H,16,17,19)/t7-/m1/s1 |
| InChIKey | UNPAMBJASNHYSD-SSDOTTSWSA-N |
| XLogP | 4.36 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|