C22H17Cl2N3O2S2 — CID 18864577
2-(2,4-dichlorophenoxy)-N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 18864577) has the molecular formula C22H17Cl2N3O2S2 and a molecular weight of 490.44 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 18864577 |
| Molecular Formula | C22H17Cl2N3O2S2 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 489.01 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc(SCc2cccc3ccccc23)s1 |
| InChI | InChI=1S/C22H17Cl2N3O2S2/c1-13(29-19-10-9-16(23)11-18(19)24)20(28)25-21-26-27-22(31-21)30-12-15-7-4-6-14-5-2-3-8-17(14)15/h2-11,13H,12H2,1H3,(H,25,26,28) |
| InChIKey | RZCSQINDYDHAOV-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|