C12H12BrN3O2S2 — CID 133160369
2-(4-bromophenoxy)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 133160369) has the molecular formula C12H12BrN3O2S2 and a molecular weight of 374.29 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 2-(4-bromophenoxy)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 133160369 |
| Molecular Formula | C12H12BrN3O2S2 |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 2-(4-bromophenoxy)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CSc1nnc(NC(=O)C(C)Oc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C12H12BrN3O2S2/c1-7(18-9-5-3-8(13)4-6-9)10(17)14-11-15-16-12(19-2)20-11/h3-7H,1-2H3,(H,14,15,17) |
| InChIKey | VFGBTZNPXNLVNG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|