C18H11Cl4N3OS2 — CID 3325273
3-(2,4-dichlorophenyl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 3325273) has the molecular formula C18H11Cl4N3OS2 and a molecular weight of 491.25 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3325273 |
| Molecular Formula | C18H11Cl4N3OS2 |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 488.91 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)Nc1nnc(SCc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C18H11Cl4N3OS2/c19-12-4-1-10(14(21)7-12)3-6-16(26)23-17-24-25-18(28-17)27-9-11-2-5-13(20)8-15(11)22/h1-8H,9H2,(H,23,24,26) |
| InChIKey | CGZHNKBRAWWHFE-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|