C19H13Cl2N3O2S2 — CID 6192126
(E)-3-(2,4-dichlorophenyl)-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 6192126) has the molecular formula C19H13Cl2N3O2S2 and a molecular weight of 450.37 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6192126 |
| Molecular Formula | C19H13Cl2N3O2S2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1nnc(SCC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C19H13Cl2N3O2S2/c20-14-8-6-12(15(21)10-14)7-9-17(26)22-18-23-24-19(28-18)27-11-16(25)13-4-2-1-3-5-13/h1-10H,11H2,(H,22,23,26)/b9-7+ |
| InChIKey | GWZFJIIWXIFNNR-VQHVLOKHSA-N |
| XLogP | 5.47 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|