C14H14ClN3O2S2 — CID 4237759
N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 4237759) has the molecular formula C14H14ClN3O2S2 and a molecular weight of 355.87 g/mol. Its IUPAC name is N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 4237759 |
| Molecular Formula | C14H14ClN3O2S2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nnc(SCC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C14H14ClN3O2S2/c1-8(2)12(20)16-13-17-18-14(22-13)21-7-11(19)9-3-5-10(15)6-4-9/h3-6,8H,7H2,1-2H3,(H,16,17,20) |
| InChIKey | IHSCPHXLKKBCKY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|