C21H16ClN5O3S2 — CID 17308356
N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide (PubChem CID 17308356) has the molecular formula C21H16ClN5O3S2 and a molecular weight of 485.98 g/mol. Its IUPAC name is N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide.
| Compound Name | N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 17308356 |
| Molecular Formula | C21H16ClN5O3S2 |
| Molecular Weight | 485.98 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
| SMILES | Cn1nc(CC(=O)Nc2nnc(SCC(=O)c3ccc(Cl)cc3)s2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H16ClN5O3S2/c1-27-19(30)15-5-3-2-4-14(15)16(26-27)10-18(29)23-20-24-25-21(32-20)31-11-17(28)12-6-8-13(22)9-7-12/h2-9H,10-11H2,1H3,(H,23,24,29) |
| InChIKey | PFSXXWOSVWDSGD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.98 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|