C21H17N5O3S2 — CID 15944346
2-(3-methyl-4-oxophthalazin-1-yl)-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 15944346) has the molecular formula C21H17N5O3S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-(3-methyl-4-oxophthalazin-1-yl)-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(3-methyl-4-oxophthalazin-1-yl)-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 15944346 |
| Molecular Formula | C21H17N5O3S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 2-(3-methyl-4-oxophthalazin-1-yl)-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | Cn1nc(CC(=O)Nc2nnc(SCC(=O)c3ccccc3)s2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H17N5O3S2/c1-26-19(29)15-10-6-5-9-14(15)16(25-26)11-18(28)22-20-23-24-21(31-20)30-12-17(27)13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,22,23,28) |
| InChIKey | QLTQZSNAZBJVEN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|