C22H20N6O3S2 — CID 24652598
N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 24652598) has the molecular formula C22H20N6O3S2 and a molecular weight of 480.58 g/mol. Its IUPAC name is N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 24652598 |
| Molecular Formula | C22H20N6O3S2 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(NC(=O)c3nn(C)c(=O)c4ccccc34)s2)c(C)c1 |
| InChI | InChI=1S/C22H20N6O3S2/c1-12-8-9-16(13(2)10-12)23-17(29)11-32-22-26-25-21(33-22)24-19(30)18-14-6-4-5-7-15(14)20(31)28(3)27-18/h4-10H,11H2,1-3H3,(H,23,29)(H,24,25,30) |
| InChIKey | HVHBGOYRDOQMDX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|