C19H19N5O4S2 — CID 25488937
N-[2-[[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 25488937) has the molecular formula C19H19N5O4S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is N-[2-[[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25488937 |
| Molecular Formula | C19H19N5O4S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[2-[[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(NC(=O)CNC(=O)c3ccco3)s2)c(C)c1 |
| InChI | InChI=1S/C19H19N5O4S2/c1-11-5-6-13(12(2)8-11)21-16(26)10-29-19-24-23-18(30-19)22-15(25)9-20-17(27)14-4-3-7-28-14/h3-8H,9-10H2,1-2H3,(H,20,27)(H,21,26)(H,22,23,25) |
| InChIKey | DYAIPVAEESTWSP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|