C19H16Cl2N4O2S2 — CID 5055523
2,4-dichloro-N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 5055523) has the molecular formula C19H16Cl2N4O2S2 and a molecular weight of 467.40 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 5055523 |
| Molecular Formula | C19H16Cl2N4O2S2 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 2,4-dichloro-N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(NC(=O)c3ccc(Cl)cc3Cl)s2)c(C)c1 |
| InChI | InChI=1S/C19H16Cl2N4O2S2/c1-10-3-6-15(11(2)7-10)22-16(26)9-28-19-25-24-18(29-19)23-17(27)13-5-4-12(20)8-14(13)21/h3-8H,9H2,1-2H3,(H,22,26)(H,23,24,27) |
| InChIKey | HNEIZNKLLNIYEC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|