C18H14Cl2N4O2S2 — CID 40832905
2,4-dichloro-N-[5-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 40832905) has the molecular formula C18H14Cl2N4O2S2 and a molecular weight of 453.38 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 40832905 |
| Molecular Formula | C18H14Cl2N4O2S2 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 2,4-dichloro-N-[5-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccccc1NC(=O)CSc1nnc(NC(=O)c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C18H14Cl2N4O2S2/c1-10-4-2-3-5-14(10)21-15(25)9-27-18-24-23-17(28-18)22-16(26)12-7-6-11(19)8-13(12)20/h2-8H,9H2,1H3,(H,21,25)(H,22,23,26) |
| InChIKey | KMKBBKGYEAFVON-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|