C19H19N5O2S2 — CID 7385428
N-(2,4-dimethylphenyl)-2-[[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7385428) has the molecular formula C19H19N5O2S2 and a molecular weight of 413.53 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7385428 |
| Molecular Formula | C19H19N5O2S2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(NC(=O)Nc3ccccc3)s2)c(C)c1 |
| InChI | InChI=1S/C19H19N5O2S2/c1-12-8-9-15(13(2)10-12)21-16(25)11-27-19-24-23-18(28-19)22-17(26)20-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,21,25)(H2,20,22,23,26) |
| InChIKey | GCYWSPFZMHFDLP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|