C12H12N4O3S2 — CID 41017055
methyl 2-[[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 41017055) has the molecular formula C12H12N4O3S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is methyl 2-[[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 41017055 |
| Molecular Formula | C12H12N4O3S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | methyl 2-[[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C12H12N4O3S2/c1-19-9(17)7-20-12-16-15-11(21-12)14-10(18)13-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,13,14,15,18) |
| InChIKey | XPWQTGBRUJNNNO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|