C14H15N3O3S3 — CID 100591935
methyl 2-[[5-[[(2S)-2-phenylsulfanylpropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100591935) has the molecular formula C14H15N3O3S3 and a molecular weight of 369.49 g/mol. Its IUPAC name is methyl 2-[[5-[[(2S)-2-phenylsulfanylpropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[(2S)-2-phenylsulfanylpropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100591935 |
| Molecular Formula | C14H15N3O3S3 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | methyl 2-[[5-[[(2S)-2-phenylsulfanylpropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)[C@H](C)Sc2ccccc2)s1 |
| InChI | InChI=1S/C14H15N3O3S3/c1-9(22-10-6-4-3-5-7-10)12(19)15-13-16-17-14(23-13)21-8-11(18)20-2/h3-7,9H,8H2,1-2H3,(H,15,16,19)/t9-/m0/s1 |
| InChIKey | BDTFDJHRJKBFPS-VIFPVBQESA-N |
| XLogP | 2.92 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|