C15H18N4O5S3 — CID 133251920
methyl 2-[[5-[2-(N-methylsulfonylanilino)propanoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 133251920) has the molecular formula C15H18N4O5S3 and a molecular weight of 430.53 g/mol. Its IUPAC name is methyl 2-[[5-[2-(N-methylsulfonylanilino)propanoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[2-(N-methylsulfonylanilino)propanoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 133251920 |
| Molecular Formula | C15H18N4O5S3 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | methyl 2-[[5-[2-(N-methylsulfonylanilino)propanoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)C(C)N(c2ccccc2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C15H18N4O5S3/c1-10(19(27(3,22)23)11-7-5-4-6-8-11)13(21)16-14-17-18-15(26-14)25-9-12(20)24-2/h4-8,10H,9H2,1-3H3,(H,16,17,21) |
| InChIKey | HNCOSNAQMRXERY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|