C14H18N4O3S3 — CID 133162007
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(N-methylsulfonylanilino)propanamide (PubChem CID 133162007) has the molecular formula C14H18N4O3S3 and a molecular weight of 386.52 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(N-methylsulfonylanilino)propanamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 133162007 |
| Molecular Formula | C14H18N4O3S3 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(N-methylsulfonylanilino)propanamide |
| SMILES | CCSc1nnc(NC(=O)C(C)N(c2ccccc2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C14H18N4O3S3/c1-4-22-14-17-16-13(23-14)15-12(19)10(2)18(24(3,20)21)11-8-6-5-7-9-11/h5-10H,4H2,1-3H3,(H,15,16,19) |
| InChIKey | KGUGFMYXIFIBSX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|